CAS 37208-05-2: (+)-Capsidiol

Description:(+)-Capsidiol is a natural compound classified as a sesquiterpene alcohol, primarily derived from plants, particularly those in the Capsicum genus, such as chili peppers. It is known for its role in plant defense mechanisms, exhibiting antifungal and antibacterial properties. The molecular structure of (+)-capsidiol features a bicyclic framework, which contributes to its biological activity. This compound is typically colorless to pale yellow and has a characteristic odor. In terms of solubility, it is generally soluble in organic solvents but has limited solubility in water. (+)-Capsidiol has garnered interest in various fields, including agriculture, where it is studied for its potential use as a natural pesticide, and in the food industry for its flavoring properties. Additionally, its potential health benefits are being explored in the context of nutrition and pharmacology. Overall, (+)-capsidiol represents a significant compound with diverse applications due to its unique chemical properties and biological activities.

Formula:C₁₅H₂₄O₂

InChI:InChI=1S/C15H24O2/c1-9(2)11-5-6-12-14(17)7-13(16)10(3)15(12,4)8-11/h6,10-11,13-14,16-17H,1,5,7-8H2,2-4H3/t10-,11-,13-,14-,15-/m1/s1

InChI key:InChIKey=BXXSHQYDJWZXPB-OKNSCYNVSA-N

SMILES:OC1C2=CCC(C(=C)C)CC2(C)C(C)C(O)C1

Synonyms:
(+)-Capsidiol
(1R,3R,4S,4aR,6R)-1,2,3,4,4a,5,6,7-Octahydro-4,4a-dimethyl-6-(1-methylethenyl)-1,3-naphthalenediol
1,3-Naphthalenediol, 1,2,3,4,4a,5,6,7-octahydro-4,4a-dimethyl-6-(1-methylethenyl)-, [1R-(1α,3β,4β,4aα,6α)]-
1,3-naphthalenediol, 1,2,3,4,4a,5,6,7-octahydro-4,4a-dimethyl-6-(1-methylethenyl)-, (1R,3R,4S,4aR,6R)-
(1R,3R,4S,4aR,6R)-4,4a-Dimethyl-6-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene-1,3-diol