CAS 3721-95-7
:Cyclobutanecarboxylic acid
Description:
Cyclobutanecarboxylic acid is a cyclic carboxylic acid characterized by a four-membered cyclobutane ring with a carboxyl functional group (-COOH) attached to it. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It has a relatively low boiling point compared to larger carboxylic acids, reflecting its smaller molecular size. Cyclobutanecarboxylic acid is known for its unique ring strain due to the four-membered structure, which can influence its reactivity and stability. It can participate in various chemical reactions, including esterification and decarboxylation, making it useful in organic synthesis. Additionally, it may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its applications can extend to the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H8O2
InChI:InChI=1S/C5H8O2/c6-5(7)4-2-1-3-4/h4H,1-3H2,(H,6,7)
InChI key:InChIKey=TXWOGHSRPAYOML-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCC1
Synonyms:- Cyclobutane Carboxylic Acid
- Cyclobutane-1-carboxylic acid
- Cyclobutanecarboxylate
- Cyclobutanoic acid
- Cyclobutylcarboxylic acid
- NSC 4535
- Cyclobutanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Cyclobutanecarboxylic Acid
CAS:Formula:C5H8O2Purity:>97.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:100.12Cyclobutanecarboxylic acid, 97%
CAS:Cyclobutanecarboxylic acid is used in water treatment, row materials for sodium fluosilicate potassium fluosilicateammonium fluosilicatecopper fluosilicatebarium fluosilicate and other fluosilicates and silicic tetrafluoride. It is also used in refining lead of electrolysis, as mordant and in the tr
Formula:C5H8O2Purity:97%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:100.12Cyclobutanecarboxylic acid
CAS:Formula:C5H8O2Purity:98%Color and Shape:LiquidMolecular weight:100.1158Cyclobutanecarboxylic acid
CAS:Formula:C5H8O2Purity:98%Color and Shape:LiquidMolecular weight:100.117Cyclobutanecarboxylic Acid
CAS:Controlled ProductApplications Cyclobutanecarboxylic Acid, can be used as an organic building block in the chemical synthesis. It is also an Antiinflammatory agent.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Grassy, G. et al.: Euro. J. Med. Chem., 14, 493, (1979);Formula:C5H8O2Color and Shape:NeatMolecular weight:100.12









