CymitQuimica logo

CAS 372120-55-3

:

3-Bromo-4-(trifluoromethyl)benzaldehyde

Description:
3-Bromo-4-(trifluoromethyl)benzaldehyde is an aromatic aldehyde characterized by the presence of a bromine atom and a trifluoromethyl group attached to a benzene ring. The molecular structure features a benzaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. This compound is typically a pale yellow to light brown liquid or solid, depending on its purity and temperature. It is known for its strong electron-withdrawing trifluoromethyl group, which significantly influences its chemical behavior, enhancing its electrophilicity and making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of the bromine atom also allows for further functionalization through nucleophilic substitution reactions. As with many halogenated compounds, it is important to handle 3-Bromo-4-(trifluoromethyl)benzaldehyde with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C8H4BrF3O
InChI:InChI=1S/C8H4BrF3O/c9-7-3-5(4-13)1-2-6(7)8(10,11)12/h1-4H
InChI key:MWYYNBYTVFKXSD-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C=O)Br)C(F)(F)F
Found 5 products.