CAS 372144-03-1
:3-N-Boc-Amino-3-piperidin-4-ylpropionic acid
Description:
3-N-Boc-Amino-3-piperidin-4-ylpropionic acid, with the CAS number 372144-03-1, is a chemical compound characterized by its structure, which includes a piperidine ring and a Boc (tert-butyloxycarbonyl) protecting group on the amino functionality. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules. The presence of the piperidine moiety contributes to its potential as a building block in medicinal chemistry, offering properties such as enhanced solubility and stability. The Boc group serves as a protective group for the amine, allowing for selective reactions without interfering with the amino functionality. Additionally, the propionic acid component provides a carboxylic acid functionality, which can participate in various chemical reactions, including esterification and amidation. Overall, 3-N-Boc-Amino-3-piperidin-4-ylpropionic acid is valued for its versatility in synthetic applications and its role in the design of compounds with potential therapeutic effects.
Formula:C13H24N2O4
InChI:InChI=1/C13H24N2O4/c1-13(2,3)19-12(18)15-10(8-11(16)17)9-4-6-14-7-5-9/h9-10,14H,4-8H2,1-3H3,(H,15,18)(H,16,17)
SMILES:CC(C)(C)OC(=NC(CC(=O)O)C1CCNCC1)O
Synonyms:- 3-[(tert-Butoxycarbonyl)amino]-3-piperidin-4-ylpropanoic acid
- 3-(Tert-Butoxycarbonylamino)-3-(4-Piperidyl)Propanoic Acid
- 3-(Tert-Butoxycarbonylamino)-3-(Piperidin-4-Yl)Propanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-((tert-Butoxycarbonyl)amino)-3-(piperidin-4-yl)propanoic acid
CAS:Formula:C13H24N2O4Purity:95%Color and Shape:SolidMolecular weight:272.34073-((tert-Butoxycarbonyl)amino)-3-(piperidin-4-yl)propanoic acid
CAS:3-((tert-Butoxycarbonyl)amino)-3-(piperidin-4-yl)propanoic acidPurity:95%Molecular weight:272.35g/mol3-tert-Butoxycarbonylamino-3-piperidin-4-yl-propionicacid
CAS:3-tert-Butoxycarbonylamino-3-piperidin-4-yl-propionic acid is a fine chemical that is used as a versatile building block in many chemical syntheses. It can be used as an intermediate in the synthesis of other compounds, such as pharmaceuticals and agrochemicals. 3-tert-Butoxycarbonylamino-3-piperidin-4-yl propionic acid is also useful for research purposes, for example in the study of enzyme inhibition. This compound has been shown to be a high quality reagent with a CAS number of 372144-03-1.Formula:C13H24N2O4Purity:Min. 95%Color and Shape:White/Off-White SolidMolecular weight:272.34 g/mol3-N-Boc-amino-3-(4′)-piperidine-propionic acid
CAS:Formula:C13H24N2O4Purity:97.0%Color and Shape:SolidMolecular weight:272.345



