CAS 372183-70-5

4-Chloro-N-(2-phenylethyl)-2-pyrimidinamine

Description:

4-Chloro-N-(2-phenylethyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 2 and 4. The presence of a chloro group at the 4-position contributes to its reactivity and potential biological activity. The N-(2-phenylethyl) substituent indicates that the compound has an ethyl chain attached to a phenyl group, which can influence its lipophilicity and interaction with biological targets. This compound may exhibit properties typical of pyrimidine derivatives, such as potential use in pharmaceuticals, particularly in the development of drugs targeting various diseases. Its structure suggests possible interactions with enzymes or receptors, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which are critical for its application in research and development. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₂H₁₂ClN₃

InChI: InChI=1S/C12H12ClN3/c13-11-7-9-15-12(16-11)14-8-6-10-4-2-1-3-5-10/h1-5,7,9H,6,8H2,(H,14,15,16)

InChI key: InChIKey=WRGAGIXYAMPJMQ-UHFFFAOYSA-N

SMILES: N(CCC1=CC=CC=C1)C=2N=C(Cl)C=CN2

Synonyms:

• 4-Chloro-2-[(2-phenylethyl)amino]pyrimidine
• 4-Chloro-N-(2-phenylethyl)-2-pyrimidinamine
• 2-Pyrimidinamine, 4-chloro-N-(2-phenylethyl)-

2-Chloro-4-[2-(4-Fluorophenyl)Ethyl]-6-Methylpyrimidine

CAS: 372183-70-5

2-Chloro-4-[2-(4-fluorophenyl)ethyl]-6-methylpyrimidine is a synthetic nucleoside analog that inhibits viral DNA synthesis by acting as an inhibitor of the viral enzyme ribonucleotide reductase. 2-Chloro-4-[2-(4-fluorophenyl)ethyl]-6-methylpyrimidine has been shown to be effective against various viruses, including HIV and herpes simplex virus 1. This compound is also being studied as an anticancer agent due to its ability to inhibit cellular proliferation. 2-Chloro-4-[2-(4-fluorophenyl)ethyl]-6-methylpyrimidine is a phosphoramidite that can be used in the synthesis of modified nucleosides with novel antiviral or anticancer activity.

Formula: C₁₃H₁₂ClFN₂

Purity: Min. 95%

Molecular weight: 250.7 g/mol

Ref: 3D-NC57394