CAS 3722-56-3
:(3S)-7-methoxy-3-(4-methoxyphenyl)chromane
Description:
(3S)-7-methoxy-3-(4-methoxyphenyl)chromane, identified by its CAS number 3722-56-3, is a chemical compound belonging to the class of chromanes, which are bicyclic compounds featuring a chromene structure. This substance is characterized by the presence of a methoxy group at both the 7-position of the chromane ring and the para position of a phenyl group attached at the 3-position. The stereochemistry at the 3-position is specified as S, indicating a specific spatial arrangement of its atoms. This compound may exhibit various biological activities, potentially including antioxidant properties, due to the presence of methoxy groups that can influence its reactivity and interaction with biological systems. Additionally, chromanes are often studied for their potential applications in pharmaceuticals and as natural products. The solubility, stability, and reactivity of (3S)-7-methoxy-3-(4-methoxyphenyl)chromane can vary based on environmental conditions and the presence of other chemical species.
Formula:C17H18O3
InChI:InChI=1/C17H18O3/c1-18-15-6-3-12(4-7-15)14-9-13-5-8-16(19-2)10-17(13)20-11-14/h3-8,10,14H,9,11H2,1-2H3/t14-/m1/s1
SMILES:COc1ccc(cc1)[C@@H]1Cc2ccc(cc2OC1)OC
Synonyms:- (S)-(-)-4',7-Dimethoxyisoflavan
- (S)-4',7-Dimethyl Equol
- (3S)-3,4-Dihydro-7-methoxy-3-(4-methoxyphenyl)-2H-1-benzopyran
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(S)-4',7-Dimethyl Equol
CAS:Controlled ProductApplications Intermediate for the synthesis of (S)-Equol.
References Heemstra, J. M., et al.: Org. Lett., 8, 5441(2006).Formula:C17H18O3Color and Shape:NeatMolecular weight:270.32(S)-4',7-Dimethyl equol
CAS:(S)-4',7-Dimethyl equol is an isoflavandiol, which is a metabolite of the soy isoflavone daidzein. It is produced in the human gut by bacterial metabolism, provided the individual has the appropriate intestinal microbiota capable of this transformation. The compound exhibits estrogenic activity, primarily due to its structural similarity to the endogenous hormone 17β-estradiol, allowing it to bind to estrogen receptors.
Formula:C17H18O3Purity:Min. 95%Molecular weight:270.32 g/mol

