CymitQuimica logo

CAS 3722-70-1

:

7-Chloro-3,4-dihydro-2H-1-benzopyran

Description:
7-Chloro-3,4-dihydro-2H-1-benzopyran, with the CAS number 3722-70-1, is a chemical compound that belongs to the class of benzopyrans, which are characterized by a fused benzene and pyran ring structure. This compound features a chlorine atom at the 7-position of the benzopyran ring, contributing to its unique reactivity and potential biological activity. The dihydro configuration indicates the presence of two hydrogen atoms that saturate the pyran ring, which can influence its stability and interactions. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of the chlorine substituent can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, the structural features of 7-chloro-3,4-dihydro-2H-1-benzopyran may allow for diverse synthetic modifications, leading to derivatives with varied biological activities. As with many organic compounds, its behavior in chemical reactions, stability, and potential applications would depend on the specific conditions and environments in which it is studied.
Formula:C9H9ClO
InChI:InChI=1S/C9H9ClO/c10-8-4-3-7-2-1-5-11-9(7)6-8/h3-4,6H,1-2,5H2
InChI key:InChIKey=YBIUDVWXWRPGBL-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(=CC1)CCCO2
Synonyms:
  • 2H-1-Benzopyran, 7-chloro-3,4-dihydro-
  • 7-Chloro-3,4-dihydro-2H-1-benzopyran
  • 7-Chlorochroman
  • Chroman, 7-chloro-
Found 3 products.