CAS 3725-39-1: 1-Morpholino-1-cyclododecene
Description:1-Morpholino-1-cyclododecene is an organic compound characterized by its unique structure, which includes a morpholine ring and a cyclododecene moiety. This compound typically exhibits a colorless to pale yellow liquid form and possesses a distinctive odor. It is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the morpholine group contributes to its basicity and solubility in polar solvents, while the cyclododecene structure provides a degree of rigidity and stability to the molecule. Additionally, 1-Morpholino-1-cyclododecene may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in synthetic chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper safety protocols, including the use of personal protective equipment, are recommended when working with this substance.
Formula:C16H29NO
InChI:InChI=1S/C16H29NO/c1-2-4-6-8-10-16(11-9-7-5-3-1)17-12-14-18-15-13-17/h10H,1-9,11-15H2
InChI key:InChIKey=SZTBSJOMNRSBGA-UHFFFAOYSA-N
SMILES:O1CCN(C2=CCCCCCCCCCC2)CC1
- Synonyms:
- 1-Morpholino-1-cyclododecene
- 4-(1-Cyclododecen-1-yl)morpholine
- 4-Cyclododec-1-En-1-Ylmorpholine
- Cyclododecane, morpholine deriv.
- Morpholine, 4-(1-cyclododecen-1-yl)-
- 1-Morpholinocyclododecene
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1-Morpholino-1-cyclododecene REF: 3B-M1939CAS: 3725-39-1 | >95.0%(GC) | 183.00 € | Mon 07 Apr 25 |
 | 4-(Cyclododec-1-en-1-yl)morpholine REF: IN-DA003EJ6CAS: 3725-39-1 | 95% | 51.00 €~196.00 € | Mon 14 Apr 25 |
 | 1-Morpholino-1-cyclododecene REF: 3D-DAA72539CAS: 3725-39-1 | Min. 95% | - - - | Discontinued product |
1-Morpholino-1-cyclododecene
Ref: 3B-M1939
| 5g | 183.00 € |
4-(Cyclododec-1-en-1-yl)morpholine
Ref: IN-DA003EJ6
| 1g | 51.00 € |
1-Morpholino-1-cyclododecene
Ref: 3D-DAA72539
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100g | Discontinued | Request information |
