CAS 3728-43-6
:Trimethyl-p-tolylsilane
Description:
Trimethyl-p-tolylsilane, with the CAS number 3728-43-6, is an organosilicon compound characterized by the presence of a silicon atom bonded to three methyl groups and one p-tolyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its low viscosity and volatility. It is soluble in organic solvents such as ether and benzene but is generally insoluble in water due to its hydrophobic nature. Trimethyl-p-tolylsilane is often utilized as a reagent in organic synthesis, particularly in the field of organosilicon chemistry, where it serves as a protecting group for alcohols and amines. Its structure allows for the introduction of silicon into organic molecules, which can enhance their stability and reactivity. Additionally, it may exhibit properties such as thermal stability and resistance to oxidation, making it valuable in various industrial applications, including sealants, adhesives, and coatings. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C10H16Si
InChI:InChI=1/C10H16Si/c1-9-5-7-10(8-6-9)11(2,3)4/h5-8H,1-4H3
SMILES:Cc1ccc(cc1)[Si](C)(C)C
Synonyms:- p-Tolyltrimethylsilane
- Trimethylptolylsilane
- Trimethyl(4-Methylphenyl)Silane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Trimethyl-p-tolylsilane, 95%
CAS:<p>It is employed in the production of trimethyl-(4-trimethylsilanyl-benzyl)-silane by reacting with chloro-trimethyl-silane. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. T</p>Formula:C10H16SiPurity:95%Color and Shape:Clear colorless, LiquidMolecular weight:164.32p-Tolyltrimethylsilane
CAS:<p>S16675 - p-Tolyltrimethylsilane</p>Formula:C10H16SiPurity:97+%Color and Shape:ClearMolecular weight:164.323
