CAS 3729-90-6
:3-methyl-1,5-diphenyl-1H-pyrazole
Description:
3-Methyl-1,5-diphenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features two phenyl groups attached to the 1 and 5 positions of the pyrazole ring, along with a methyl group at the 3 position. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the phenyl groups contributes to its aromatic character, which can influence its chemical reactivity and stability. 3-Methyl-1,5-diphenyl-1H-pyrazole may exhibit biological activity, making it of interest in medicinal chemistry and research. Its molecular structure allows for potential interactions with various biological targets, which can be explored for therapeutic applications. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, this compound is notable for its unique structural features and potential applications in various fields of chemistry and pharmacology.
Formula:C16H14N2
InChI:InChI=1/C16H14N2/c1-13-12-16(14-8-4-2-5-9-14)18(17-13)15-10-6-3-7-11-15/h2-12H,1H3
SMILES:Cc1cc(c2ccccc2)n(c2ccccc2)n1
Synonyms:- 1,5-Diphenyl-3-methyl-1H-pyrazole
- 1H-pyrazole, 3-methyl-1,5-diphenyl-
- 3729-90-6
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,5-Diphenyl-3-methylpyrazole
CAS:Controlled ProductApplications 1,5-Diphenyl-3-methylpyrazole (cas# 3729-90-6) is a useful research chemical.
Formula:C16H14N2Color and Shape:NeatMolecular weight:234.3
