CAS 372941-46-3
:1-(4-fluorophenyl)-3-oxo-1H-isobenzofuran-5-carboxamide
Description:
1-(4-Fluorophenyl)-3-oxo-1H-isobenzofuran-5-carboxamide, with the CAS number 372941-46-3, is a synthetic organic compound characterized by its complex structure, which includes an isobenzofuran core. This compound features a carboxamide functional group and a fluorophenyl substituent, contributing to its potential biological activity. The presence of the fluorine atom may enhance lipophilicity and influence the compound's interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including anti-inflammatory or anticancer activities. The molecular structure suggests that it may exhibit specific reactivity patterns, making it a candidate for further research in medicinal chemistry. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions, which are crucial for its application in drug development. Overall, this compound represents a class of molecules that are of interest in the field of pharmaceutical chemistry due to their potential therapeutic applications.
Formula:C15H10FNO3
InChI:InChI=1/C15H10FNO3/c16-10-4-1-8(2-5-10)13-11-6-3-9(14(17)18)7-12(11)15(19)20-13/h1-7,13H,(H2,17,18)
SMILES:c1cc(ccc1C1c2ccc(cc2C(=O)O1)C(=N)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-(4-Fluorophenyl)-1,3-dihydro-3-oxo-5-isobenzofurancarboxamide
CAS:Formula:C15H10FNO3Color and Shape:SolidMolecular weight:271.24321-(4-Fluorophenyl)-1,3-dihydro-3-oxo-5-isobenzofurancarboxamide
CAS:Controlled ProductApplications An intermediate for the preparation of Citalopram.
Formula:C15H10FNO3Color and Shape:NeatMolecular weight:271.24


