CAS 372941-48-5
:1-(4-fluorophenyl)-3-oxo-1,3-dihydro-2-benzofuran-5-carbonitrile
Description:
1-(4-Fluorophenyl)-3-oxo-1,3-dihydro-2-benzofuran-5-carbonitrile, identified by its CAS number 372941-48-5, is a synthetic organic compound characterized by its complex structure that includes a benzofuran moiety, a carbonitrile group, and a fluorophenyl substituent. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of functional groups such as the carbonitrile and ketone. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or altering its interaction with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of new drugs, due to their unique structural features that may confer specific biological activities. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a subject of interest in synthetic organic chemistry.
Formula:C15H8FNO2
InChI:InChI=1/C15H8FNO2/c16-11-4-2-10(3-5-11)14-12-6-1-9(8-17)7-13(12)15(18)19-14/h1-7,14H
SMILES:c1cc2c(cc1C#N)C(=O)OC2c1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-Fluorophenyl)-1,3-dihydro-3-oxo-5-isobenzofurancarbonitrile
CAS:Controlled ProductApplications An intermediate for the preparation of Citalopram.
Formula:C15H8FNO2Color and Shape:NeatMolecular weight:253.23
