CAS 372963-49-0
:5-Methyl-2-pyridineboronic acid
Description:
5-Methyl-2-pyridineboronic acid is an organoboron compound characterized by the presence of a pyridine ring substituted with a methyl group and a boronic acid functional group. Its molecular structure features a five-membered aromatic ring containing nitrogen, which contributes to its unique chemical properties. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. It is often used as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 5-Methyl-2-pyridineboronic acid can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H8BNO2
InChI:InChI=1/C6H8BNO2/c1-5-2-3-6(7(9)10)8-4-5/h2-4,9-10H,1H3
SMILES:Cc1ccc(B(O)O)nc1
Synonyms:- 5-Methylpyridine-2-boronic acid
- (5-Methylpyridin-2-Yl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Methylpyridine-2-boronic acid, 95%
CAS:<p>5-Methylpyridine-2-boronic acid is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / ite</p>Formula:C6H8BNO2Purity:95%Molecular weight:136.955-Methylpyridine-2-boronic acid
CAS:Formula:C6H8BNO2Purity:96%Color and Shape:SolidMolecular weight:136.94425-Methylpyridine-2-boronic acid
CAS:5-Methylpyridine-2-boronic acidFormula:C6H8BNO2Purity:95%Color and Shape: white solidMolecular weight:136.94g/mol(5-Methylpyridin-2-yl)boronic acid
CAS:Formula:C6H8BNO2Purity:96%Color and Shape:SolidMolecular weight:136.955-Methylpyridine-2-boronicacid
CAS:Please enquire for more information about 5-Methylpyridine-2-boronicacid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C6H8BNO2Purity:Min. 95%Molecular weight:136.94 g/mol




