CymitQuimica logo

CAS 372963-49-0

:

5-Methyl-2-pyridineboronic acid

Description:
5-Methyl-2-pyridineboronic acid is an organoboron compound characterized by the presence of a pyridine ring substituted with a methyl group and a boronic acid functional group. Its molecular structure features a five-membered aromatic ring containing nitrogen, which contributes to its unique chemical properties. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. It is often used as a building block in the synthesis of more complex molecules, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 5-Methyl-2-pyridineboronic acid can participate in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H8BNO2
InChI:InChI=1/C6H8BNO2/c1-5-2-3-6(7(9)10)8-4-5/h2-4,9-10H,1H3
InChI key:VDRIXWWGBDNWCM-UHFFFAOYSA-N
SMILES:Cc1ccc(B(O)O)nc1
Synonyms:
  • 5-Methylpyridine-2-boronic acid
  • (5-Methylpyridin-2-Yl)Boronic Acid
Found 6 products.