CAS 372963-51-4
:B-(6-Methoxy-2-pyridinyl)boronic acid
Description:
B-(6-Methoxy-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is substituted with a methoxy group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The methoxy group enhances the compound's solubility and can influence its reactivity and interaction with biological targets. Additionally, the presence of the pyridine ring contributes to the compound's aromatic character and can affect its electronic properties. Overall, B-(6-Methoxy-2-pyridinyl)boronic acid is a versatile building block in the synthesis of complex organic molecules and has potential applications in drug discovery and development.
Formula:C6H8BNO3
InChI:InChI=1S/C6H8BNO3/c1-11-6-4-2-3-5(8-6)7(9)10/h2-4,9-10H,1H3
InChI key:InChIKey=GQWZKBTZAFEQJZ-UHFFFAOYSA-N
SMILES:B(O)(O)C=1N=C(OC)C=CC1
Synonyms:- (6-Methoxypyridin-2-yl)boronic acid
- 2-Methoxypyridine-6-boronic acid
- 6-Methoxy-2-pyridylboronic acid
- 6-Methoxypyridin-2-ylboronic acid
- 6-Methoxypyridine-2-boronic acid
- B-(6-Methoxy-2-pyridinyl)boronic acid
- Boronic acid, (6-methoxy-2-pyridinyl)-
- Boronicacid, (6-methoxy-2-pyridinyl)- (9CI)
- [6-(Methyloxy)-2-pyridinyl]boronic acid
- boronic acid, B-(6-methoxy-2-pyridinyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(6-methoxypyridin-2-yl)boronic acid
CAS:Formula:C6H8BNO3Purity:97%Color and Shape:SolidMolecular weight:152.94366-Methoxypyridine-2-boronic acid
CAS:6-Methoxypyridine-2-boronic acidFormula:C6H8BNO3Purity:97%Color and Shape: white to off-white solidMolecular weight:152.94g/mol(6-Methoxypyridin-2-yl)boronic acid
CAS:Formula:C6H8BNO3Purity:97%Color and Shape:SolidMolecular weight:152.946-Methoxypyridine-2-boronic acid
CAS:6-Methoxypyridine-2-boronic acid is a boronate ligand that can be used to form coordination complexes with metals. It has been shown to interact with silver ions, which are the most effective ligands for enhancing the fluorescence of organic dyes. 6-Methoxypyridine-2-boronic acid is able to rigidify organic molecules by binding to their steric and electronic properties, making them more resistant to photodegradation. This property makes it an excellent candidate for the use in the development of fluorescent labels in analytical chemistry.Formula:C6H8BNO3Purity:Min. 95%Molecular weight:152.94 g/mol



