CAS 37299-86-8
:Xanthylium, 9-(2,4-dicarboxyphenyl)-3,6-bis(diethylamino)-, chloride, sodium salt (1:1:2)
Description:
Xanthylium, 9-(2,4-dicarboxyphenyl)-3,6-bis(diethylamino)-, chloride, sodium salt (1:1:2), with the CAS number 37299-86-8, is a synthetic organic compound belonging to the xanthene dye family. This substance is characterized by its complex structure, which includes a xanthylium core substituted with diethylamino groups and a dicarboxyphenyl moiety, contributing to its unique chemical properties. The presence of the chloride and sodium salt indicates its ionic nature, which can influence its solubility and stability in various solvents. Xanthylium dyes are known for their vibrant colors and are often utilized in applications such as biological staining, fluorescence microscopy, and as pH indicators due to their sensitivity to changes in the environment. The compound's ability to form complexes and its photophysical properties make it valuable in research and industrial applications. Additionally, the presence of multiple functional groups allows for potential modifications, enhancing its versatility in chemical synthesis and material science.
Formula:C29H31N2O5·Cl·2Na
InChI:InChI=1S/C29H30N2O5.ClH.2Na/c1-5-30(6-2)19-10-13-22-25(16-19)36-26-17-20(31(7-3)8-4)11-14-23(26)27(22)21-12-9-18(28(32)33)15-24(21)29(34)35;;;/h9-17H,5-8H2,1-4H3,(H-,32,33,34,35);1H;;
InChI key:InChIKey=AYMUHTYYRNTEJN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=2C3=C([O+]=C4C2C=CC(N(CC)CC)=C4)C=C(N(CC)CC)C=C3)C=CC(C(O)=O)=C1.[Cl-].[Na]
Synonyms:- Ethanaminium,N-[9-(2,4-dicarboxyphenyl)-6-(diethylamino)-3H-xanthen-3-ylidene]-N-ethyl-,chloride, disodium salt
- Rhodamine Wt
- Xanthylium, 9-(2,4-dicarboxyphenyl)-3,6-bis(diethylamino)-, chloride, disodium salt
- Xanthylium,9-(2,4-dicarboxyphenyl)-3,6-bis(diethylamino)-, chloride, disodium salt (9CI)
- Xanthylium, 9-(2,4-dicarboxyphenyl)-3,6-bis(diethylamino)-, chloride, sodium salt (1:1:2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Rhodamine WT, 20% aqueous solution
CAS:Rhodamine is a fluorescent compound that, in a 20% aqueous solution, serves as an effective fluorescent probe for detecting nitrite ions (NO2). When exposed to ultraviolet light, it undergoes a remarkable color change in response to nitrite presence. Beyond nitrite detection, rhodamine also interacts with various chemical substances, including organic solvents commonly found in wastewater treatment systems, which shows its potential, especially in environmental monitoring and analytical chemistry applications. This 20% solution is 20% w/w. Our sales mass in g is the final mass of the solution.
Formula:C29H29N2O5·Cl·2NaPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:567 g/mol
