CymitQuimica logo

CAS 373-05-7

:

6-Fluorohexanoic acid

Description:
6-Fluorohexanoic acid is a fluorinated carboxylic acid characterized by the presence of a fluorine atom at the sixth carbon of a hexanoic acid chain. Its molecular formula is C6H11F O2, and it features a straight-chain structure typical of fatty acids. This compound is typically a colorless liquid or solid, depending on temperature, and exhibits a pungent odor. It is soluble in polar solvents like water and alcohols due to its carboxylic acid functional group, which can engage in hydrogen bonding. The presence of the fluorine atom can impart unique chemical properties, such as increased lipophilicity and altered reactivity compared to non-fluorinated analogs. 6-Fluorohexanoic acid is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as an intermediate in chemical reactions. However, safety considerations are paramount, as fluorinated compounds can exhibit toxicity and environmental persistence. Proper handling and disposal protocols should be followed to mitigate any risks associated with its use.
Formula:C6H11FO2
InChI:InChI=1S/C6H11FO2/c7-5-3-1-2-4-6(8)9/h1-5H2,(H,8,9)
InChI key:InChIKey=QDVPGZOKFHEOIW-UHFFFAOYSA-N
SMILES:C(CC(O)=O)CCCF
Synonyms:
  • Hexaneperoxoic acid, 6-fluoro-
  • Hexanoic Acid, 6-Fluoro-
  • 6-Fluorohexanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.