CAS 3732-31-8
:1,1'-Biadamantane
Description:
1,1'-Biadamantane, with the CAS number 3732-31-8, is a polycyclic hydrocarbon characterized by its unique structure, which consists of two adamantane units linked by a single bond. This compound exhibits a high degree of stability due to the rigid, cage-like structure of the adamantane framework, which contributes to its low reactivity. It is typically a white crystalline solid at room temperature and is insoluble in water but soluble in organic solvents. The compound has garnered interest in materials science and nanotechnology due to its potential applications in drug delivery systems and as a building block for advanced materials. Its thermal stability and mechanical properties make it suitable for various applications, including the development of high-performance polymers. Additionally, 1,1'-Biadamantane's unique structural features allow for potential modifications that can enhance its properties or introduce new functionalities, making it a subject of ongoing research in organic and materials chemistry.
Formula:C20H30
InChI:InChI=1/C20H30/c1-13-2-15-3-14(1)8-19(7-13,9-15)20-10-16-4-17(11-20)6-18(5-16)12-20/h13-18H,1-12H2
SMILES:C1C2CC3CC1CC(C2)(C3)C12CC3CC(CC(C3)C2)C1
Synonyms:- 1,1'-Bi(Tricyclo[3.3.1.1~3,7~]Decane)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,1'-Diadamantyl
CAS:1,1'-Diadamantyl is a fluorescent dye that has been used extensively in the field of analytical chemistry. It has a Raman spectrum with peaks at 629, 635, and 702 nm. 1,1'-Diadamantyl can be analyzed by vibrational spectroscopy and it has been shown to have a skeleton with two hydroxy groups. This dye is soluble in organic solvents and it absorbs light of different wavelengths in the visible range. The constant for this compound is 2.65 x 10-6 L mol-1 cm-1 and its average particle diameter is about 25 nanometers.Formula:C20H30Purity:Min. 95%Color and Shape:White PowderMolecular weight:270.45 g/mol



