CAS 3732-82-9
:Thiohempa
Description:
Thiohempa, with the CAS number 3732-82-9, is a chemical compound that belongs to the class of thioether compounds. It is characterized by the presence of a sulfur atom bonded to carbon atoms, which imparts unique properties compared to its oxygen-containing counterparts. Thiohempa is primarily recognized for its application in the field of medicinal chemistry, particularly as a potential therapeutic agent. It exhibits a range of biological activities, including neuroprotective effects, which have garnered interest in pharmacological research. The compound is typically a colorless to pale yellow liquid, and its solubility can vary depending on the solvent used. Thiohempa's molecular structure contributes to its reactivity and interaction with biological systems, making it a subject of study for its potential benefits in treating various conditions. As with many chemical substances, safety and handling precautions are essential due to its potential toxicity and environmental impact.
Formula:C6H18N3PS
InChI:InChI=1S/C6H18N3PS/c1-7(2)10(11,8(3)4)9(5)6/h1-6H3
InChI key:InChIKey=NPKXLCMBIGGTTQ-UHFFFAOYSA-N
SMILES:P(N(C)C)(N(C)C)(N(C)C)=S
Synonyms:- 3732-82-9
- Ent 50918
- Hexamethylphosphorothioic triamide
- Hexamethylthiophosphoramide
- Hexamethylthiophosphoric triamide
- Hmpts
- Phosphorothioic triamide, hexamethyl-
- Thio-HMPA
- Thiohempa
- Thiopol
- Tris(dimethylamino)phosphine sulfide
- phosphorothioic triamide, N,N,N',N',N'',N''-hexamethyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Thiohempa
CAS:Thiohempa is an anticancer drug that has been shown to inhibit tumor growth by targeting kinases, which are enzymes involved in cell signaling pathways. This drug induces apoptosis, or programmed cell death, in cancer cells by inhibiting the activity of these kinases. Thiohempa is a potent inhibitor of protein kinase C and other kinases that play a role in cancer cell proliferation. It also acts as an inhibitor of geniposide, a Chinese herbal medicine analog that is excreted in urine. Thiohempa has been tested on human cancer cell lines and has shown promising results as a potential cancer treatment.Formula:C6H18N3PSPurity:Min. 95%Molecular weight:195.27 g/mol
