CAS 373356-52-6: N-Methyl-5-phenyl-1H-pyrazole-3-methanamine
Description:N-Methyl-5-phenyl-1H-pyrazole-3-methanamine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group attached to the nitrogen atom at the 1-position and a phenyl group at the 5-position, contributing to its aromatic properties. The presence of the methanamine group at the 3-position enhances its potential for hydrogen bonding and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it may interact with various biological targets, potentially influencing pathways related to neurotransmission or other physiological processes. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C11H13N3
InChI:InChI=1S/C11H13N3/c1-12-8-10-7-11(14-13-10)9-5-3-2-4-6-9/h2-7,12H,8H2,1H3,(H,13,14)
InChI key:InChIKey=DZKXCPRBGCYVCH-UHFFFAOYSA-N
SMILES:N=1NC(=CC1CNC)C=2C=CC=CC2
- Synonyms:
- 1H-pyrazole-3-methanamine, N-methyl-5-phenyl-
- Methyl-(5-Phenyl-1H-Pyrazol-3-Ylmethyl)-Amine
- N-Methyl-5-phenyl-1H-pyrazole-3-methanamine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | N-Methyl-1-(5-phenyl-1H-pyrazol-3-yl)methanamine REF: IN-DA007A0ECAS: 373356-52-6 | - - - | To inquire | Mon 21 Apr 25 |
 | N-methyl-1-(5-phenyl-1H-pyrazol-3-yl)methanamine oxalate REF: 10-F360859CAS: 373356-52-6 | 95.0% | To inquire | Tue 29 Apr 25 |
| N-methyl-1-(5-phenyl-1H-pyrazol-3-yl)methanamine REF: 10-F313524CAS: 373356-52-6 | 95.0% | - - - | Discontinued product |
 | Methyl-(5-Phenyl-1H-Pyrazol-3-Ylmethyl)-Amine REF: 3D-FM51313CAS: 373356-52-6 | Min. 95% | - - - | Discontinued product |
N-Methyl-1-(5-phenyl-1H-pyrazol-3-yl)methanamine
Ref: IN-DA007A0E
| Undefined size | To inquire |
N-methyl-1-(5-phenyl-1H-pyrazol-3-yl)methanamine oxalate
Ref: 10-F360859
| 1g | To inquire | ||
| 250mg | To inquire |
N-methyl-1-(5-phenyl-1H-pyrazol-3-yl)methanamine
Ref: 10-F313524
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
Methyl-(5-Phenyl-1H-Pyrazol-3-Ylmethyl)-Amine
Ref: 3D-FM51313
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
