CAS 373384-18-0
:[3-(Methylsulfonyl)phenyl]-boronic acid
Description:
[3-(Methylsulfonyl)phenyl]-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has a methylsulfonyl substituent. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methylsulfonyl group enhances the compound's solubility in polar solvents and may influence its reactivity and biological activity. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in forming carbon-carbon bonds in the synthesis of complex organic molecules. The presence of the methylsulfonyl group may also impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. Overall, [3-(Methylsulfonyl)phenyl]-boronic acid is a versatile compound with significant implications in both synthetic and pharmaceutical chemistry.
Formula:C7H9BO4S
InChI:InChI=1/C7H9BO4S/c1-13(11,12)7-4-2-3-6(5-7)8(9)10/h2-5,9-10H,1H3
SMILES:CS(=O)(=O)c1cccc(c1)B(O)O
Synonyms:- (3-Methylsulfonylphenyl)boronic acid
- 3-(Methylsulfonyl)Phenylboronic Acid
- 3-(Methanesulfonyl)phenyl boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Methylsulfonyl)benzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H9BO4SPurity:98%Molecular weight:200.02(3-(Methylsulfonyl)phenyl)boronic acid
CAS:Formula:C7H9BO4SPurity:98%Color and Shape:SolidMolecular weight:200.02003-(Methylsulphonyl)benzeneboronic acid
CAS:3-(Methylsulphonyl)benzeneboronic acidFormula:C7H9BO4SPurity:98%Color and Shape: white to off-white solidMolecular weight:200.01996g/mol3-Methylsulfonylphenylboronic acid
CAS:Formula:C7H9BO4SPurity:96%Color and Shape:SolidMolecular weight:200.02




