CAS 373384-19-1

(1,2-dihydro-2-oxo-5-Pyrimidinyl)-boronic acid

Description:

(1,2-Dihydro-2-oxo-5-pyrimidinyl)-boronic acid is a boronic acid derivative characterized by its unique pyrimidine structure, which includes a dihydro-2-oxo group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyrimidine ring contributes to its potential biological activity, as pyrimidines are often found in nucleic acids and other biologically relevant molecules. The compound may also exhibit moderate solubility in polar solvents due to the presence of the boronic acid functional group, which can engage in hydrogen bonding. Additionally, it may display specific reactivity patterns, particularly in cross-coupling reactions, which are valuable in the synthesis of complex organic compounds. Overall, (1,2-dihydro-2-oxo-5-pyrimidinyl)-boronic acid represents a versatile building block in chemical research and development.

Formula: C₄H₅BN₂O₃

InChI: InChI=1/C4H5BN2O3/c8-4-6-1-3(2-7-4)5(9)10/h1-2,9-10H,(H,6,7,8)

SMILES: c1c(cnc(n1)O)B(O)O

Synonyms:

• 1,2-Dihydro-2-Oxopyrimidin-5-Yl-5-Boronic Acid
• (2-Hydroxypyrimidin-5-Yl)Boronic Acid

(1,2-dihydro-2-oxo-5-Pyrimidinyl)-boronic acid

CAS: 373384-19-1

Formula: C₄H₅BN₂O₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 139.9051

Ref: IN-DA00BXZK

2-Hydroxypyrimidine-5-boronic acid

CAS: 373384-19-1

2-Hydroxypyrimidine-5-boronic acid

Formula: C₄H₅BN₂O₃

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 139.91g/mol

Ref: 54-OR45097

(2-Hydroxypyrimidin-5-yl)boronic acid

CAS: 373384-19-1

Formula: C₄H₅BN₂O₃

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 139.91

Ref: 10-F319224

2-Hydroxypyrimidine-5-boronicacid

CAS: 373384-19-1

Please enquire for more information about 2-Hydroxypyrimidine-5-boronicacid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₄H₅BN₂O₃

Purity: Min. 95%

Molecular weight: 139.91 g/mol

Ref: 3D-FH151148