CAS 373603-69-1: 4-(Trifluoromethyl)piperidin-4-ol
Description:4-(Trifluoromethyl)piperidin-4-ol is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a trifluoromethyl group (-CF3) at the 4-position of the piperidine ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The hydroxyl group (-OH) at the same position contributes to its polarity and can participate in hydrogen bonding, affecting its solubility in various solvents. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the design of pharmaceuticals that target specific biological pathways. Its unique electronic and steric properties, derived from the trifluoromethyl group, may enhance the compound's interaction with biological targets. Additionally, the compound's stability and reactivity can be influenced by the presence of the trifluoromethyl and hydroxyl groups, making it a subject of study in synthetic and medicinal chemistry.
Formula:C6H10F3NO
InChI:InChI=1S/C6H10F3NO/c7-6(8,9)5(11)1-3-10-4-2-5/h10-11H,1-4H2
InChI key:InChIKey=AXPLSJSIKGZOMF-UHFFFAOYSA-N
SMILES:FC(F)(F)C1(O)CCNCC1
- Synonyms:
- 4-(Trifluoromethyl)-4-piperidinol
- 4-Hydroxy-4-trifluoromethylpiperidine
- 4-Piperidinol, 4-(trifluoromethyl)-
- 4-Trifluoromethylpiperidin-4-ol
4-trifluoromethyl-piperidin-4-ol
Ref: IN-DA00C6WW
| 1g | 103.00 € | ||
| 5g | 294.00 € | ||
| 10g | 482.00 € | ||
| 25g | To inquire | ||
| 100mg | 31.00 € | ||
| 250mg | 47.00 € |
4-(Trifluoromethyl)piperidin-4-ol
Ref: 54-PC53436
| 1g | 147.00 € |
4-(Trifluoromethyl)piperidin-4-ol
Ref: 10-F229594
| 1g | 75.00 € | ||
| 5g | 312.00 € | ||
| 10g | 475.00 € | ||
| 250mg | 34.00 € |
4-(Trifluoromethyl)piperidin-4-ol
Ref: 3D-YPA60369
| 5g | 465.00 € |
