CAS 37364-66-2
:Bleomycinic acid
Description:
Bleomycinic acid, with the CAS number 37364-66-2, is a chemical compound that is a derivative of bleomycin, an antibiotic used primarily in cancer treatment. It is characterized by its complex structure, which includes a glycopeptide moiety and a unique metal-binding site that allows it to interact with DNA. This interaction leads to the formation of free radicals, resulting in DNA strand breaks, which is a key mechanism in its anticancer activity. Bleomycinic acid is typically less active than its parent compound, bleomycin, but it retains some biological properties. The compound is soluble in water and exhibits stability under physiological conditions, making it suitable for various pharmaceutical applications. Its use is primarily in the context of cancer therapy, where it is employed to target rapidly dividing cells. However, like many chemotherapeutic agents, it can have side effects, including pulmonary toxicity and skin reactions, necessitating careful monitoring during treatment. Overall, bleomycinic acid represents an important compound in the field of oncology and medicinal chemistry.
Formula:C50H72N16O22S2
InChI:InChI=1/C50H72N16O22S2/c1-15-28(63-41(66-39(15)53)20(7-26(52)70)58-8-19(51)40(54)76)44(79)65-30(36(21-9-56-14-59-21)86-49-38(34(74)32(72)24(10-67)85-49)87-48-35(75)37(88-50(55)83)33(73)25(11-68)84-48)45(80)60-17(3)31(71)16(2)42(77)64-29(18(4)69)43(78)57-6-5-27-61-22(12-89-27)46-62-23(13-90-46)47(81)82/h9,12-14,16-20,24-25,29-38,48-49,58,67-69,71-75H,5-8,10-11,51H2,1-4H3,(H2,52,70)(H2,54,76)(H2,55,83)(H,56,59)(H,57,78)(H,60,80)(H,64,77)(H,65,79)(H,81,82)(H2,53,63,66)
InChI key:InChIKey=MRNLLBXPSWMYCK-UHFFFAOYSA-N
SMILES:C(C(NC(=O)C1=NC(C(NCC(C(N)=O)N)CC(N)=O)=NC(N)=C1C)C(NC(C(C(C(NC(C(NCCC2=NC(=CS2)C3=NC(C(O)=O)=CS3)=O)C(C)O)=O)C)O)C)=O)(OC4C(OC5C(O)C(OC(N)=O)C(O)C(CO)O5)C(O)C(O)C(CO)O4)C6=CN=CN6
Synonyms:- Bleomycinic acid
- Bleomycin acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bleomycin Acid
CAS:Controlled ProductFormula:C50H72N16O22S2Color and Shape:NeatMolecular weight:1313.331Bleomycin acid
CAS:Bleomycin acid is a chemotherapeutic agent, which is a derivative of antibiotics isolated from the bacterium *Streptomyces verticillus*. This bioactive compound exhibits its mode of action primarily through binding to DNA and inducing strand breaks. The interaction of bleomycin acid with DNA leads to the formation of free radicals, which subsequently result in single and double-strand breaks. These actions disrupt the DNA synthesis and repair processes, ultimately inhibiting cancer cell proliferation.Formula:C50H72N16O22S2Purity:Min. 95%Molecular weight:1,313.3 g/molRef: 4Z-B-190003
Discontinued product



