CAS 37386-15-5
:Pyrrolidin-1-ylacetic acid
Description:
Pyrrolidin-1-ylacetic acid, with the CAS number 37386-15-5, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an acetic acid functional group attached to the nitrogen atom of the pyrrolidine ring, contributing to its properties as an amino acid derivative. Pyrrolidin-1-ylacetic acid is typically a white to off-white solid, and it is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Its structural characteristics allow for potential interactions with various biological targets, and it may participate in reactions typical of both amines and carboxylic acids. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C6H11NO2
InChI:InChI=1/C6H11NO2/c8-6(9)5-7-3-1-2-4-7/h1-5H2,(H,8,9)
SMILES:C1CCN(C1)CC(=O)O
Synonyms:- 1-Pyrrolidineacetic acid
- Pyrrolidin-1-Yl-Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrrolidin-1-yl-acetic acid
CAS:Formula:C6H11NO2Purity:95%Color and Shape:SolidMolecular weight:129.159Pyrrolidin-1-ylacetic acid
CAS:Formula:C6H11NO2Purity:95%Color and Shape:SolidMolecular weight:129.15701-Pyrrolidineacetic Acid
CAS:Controlled Product<p>Applications 1-Pyrrolidineacetic Acid is a useful reactant and reagent in organic reactions. It can be found used in cosmetic products such as wrinkle-preventive/ameliorating products.<br>References Londregan, A.T., et al.: ACS Comb. Sci., 18, 651-54 (2016); Tsunenaga, M., et al.: PCT Int. Appl. (2007), WO 2007013662 A1<br></p>Formula:C6H11NO2Color and Shape:NeatMolecular weight:129.16



