CAS 3739-81-9
:1-methylpyrimidin-2(1H)-one
Description:
1-Methylpyrimidin-2(1H)-one, with the CAS number 3739-81-9, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a methyl group and a carbonyl group at the 2-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents such as water and alcohols, which is indicative of its polar functional groups. The presence of the carbonyl group contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. 1-Methylpyrimidin-2(1H)-one is of interest in medicinal chemistry and may serve as a building block in the synthesis of pharmaceuticals and agrochemicals. Its biological activity can vary, and it may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological data would depend on further studies. Proper handling and storage are essential due to its chemical nature, and safety data sheets should be consulted for detailed safety information.
Formula:C5H6N2O
InChI:InChI=1/C5H6N2O/c1-7-4-2-3-6-5(7)8/h2-4H,1H3
SMILES:Cn1cccnc1=O
Synonyms:- 2(1H)-pyrimidinone, 1-methyl-
- 1-Methylpyrimidin-2(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
1-Methyl-1,2-dihydropyrimidin-2-one
CAS:Formula:C5H6N2OColor and Shape:SolidMolecular weight:110.11391-Methyl-1,2-dihydropyrimidin-2-one
CAS:Controlled Product<p>Applications 1-methyl-1,2-dihydropyrimidin-2-one (cas# 3739-81-9) is a useful research chemical.<br></p>Formula:C5H6N2OColor and Shape:NeatMolecular weight:110.12




