CAS 37390-66-2

2,6-Dichloro-9-(2-deoxy-β-D-erythro-pentofuranosyl)-9H-purine

Description:

2,6-Dichloro-9-(2-deoxy-β-D-erythro-pentofuranosyl)-9H-purine, commonly known as a nucleoside analog, is characterized by its structural components, which include a purine base and a sugar moiety. The presence of two chlorine atoms at the 2 and 6 positions of the purine ring enhances its biological activity and stability. This compound is primarily recognized for its antiviral properties, particularly against certain viral infections, as it can interfere with viral replication processes. The 2-deoxy-β-D-erythro-pentofuranosyl sugar component contributes to its ability to mimic natural nucleosides, allowing it to be incorporated into nucleic acids. Its solubility in water and organic solvents varies, which can influence its bioavailability and pharmacokinetics. Additionally, the compound's molecular structure allows for potential interactions with various enzymes involved in nucleic acid metabolism, making it a subject of interest in medicinal chemistry and drug development. Overall, 2,6-Dichloro-9-(2-deoxy-β-D-erythro-pentofuranosyl)-9H-purine exemplifies the intricate relationship between chemical structure and biological function.

Formula: C₁₀H₁₀Cl₂N₄O₃

InChI: InChI=1S/C10H10Cl2N4O3/c11-8-7-9(15-10(12)14-8)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2/t4-,5+,6+/m0/s1

InChI key: InChIKey=WCBMAWWRSUVVSE-KVQBGUIXSA-N

SMILES: ClC1=C2C(N(C=N2)[C@@H]3O[C@H](CO)[C@@H](O)C3)=NC(Cl)=N1

Synonyms:

• 2,6-Dichloropurine deoxyriboside
• 9H-Purine, 2,6-dichloro-9-(2-deoxy-β-D-erythro-pentofuranosyl)-
• 2,6-Dichloro-9-(2-deoxy-β-D-erythro-pentofuranosyl)-9H-purine
• 2,6-Dichloro-9-(2'-deoxy-b-D-ribofuranosyl)purine
• 2,6-DICHLOROPURINE-2'-DEOXYRIBOSIDE

2,6-Dichloro-9-(2'-deoxy-b-D-ribofuranosyl)purine

CAS: 37390-66-2

2,6-Dichloro-9-(2'-deoxy-β-D-ribofuranosyl)purine is a synthetic compound that is used in the treatment of certain types of cancer. It has been shown to be an activator of DNA synthesis and an inhibitor of RNA synthesis. It has also been shown to inhibit tumor growth and prolong the survival time for patients with leukemia. The antiviral activity of 2,6-dichloro-9-(2'-deoxy-β-D-ribofuranosyl)purine may be due to its ability to inhibit viral DNA polymerase. This drug is also known as dideoxyinosine (ddI).

Formula: C₁₀H₁₀Cl₂N₄O₃

Purity: Min. 95%

Molecular weight: 305.12 g/mol

Ref: 3D-ND08402