CAS 37398-23-5
:N-[4-Hydroxy-3-(methylthio)phenyl]acetamide
Description:
N-[4-Hydroxy-3-(methylthio)phenyl]acetamide, with the CAS number 37398-23-5, is an organic compound characterized by its acetamide functional group attached to a phenolic structure. This compound features a hydroxyl group (-OH) and a methylthio group (-S-CH3) on the aromatic ring, which contribute to its chemical reactivity and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents, while the methylthio group may influence its electronic properties and steric hindrance. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by environmental factors such as pH and temperature. Overall, N-[4-Hydroxy-3-(methylthio)phenyl]acetamide represents a unique chemical entity with potential utility in various scientific fields, including pharmaceuticals and biochemistry.
Formula:C9H11NO2S
InChI:InChI=1S/C9H11NO2S/c1-6(11)10-7-3-4-8(12)9(5-7)13-2/h3-5,12H,1-2H3,(H,10,11)
InChI key:InChIKey=KNDKLDWGYWQCCJ-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=CC(SC)=C(O)C=C1
Synonyms:- 3-(Methylthio)acetaminophen
- 3-(Methylthio)paracetamol
- 4′-Hydroxy-3′-(methylthio)acetanilide
- Acetamide, N-[4-hydroxy-3-(methylthio)phenyl]-
- N-[4-Hydroxy-3-(methylthio)phenyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S-Methyl-3-thioacetaminophen
CAS:Controlled ProductApplications S-Methyl-3-thioacetaminophen is a metabolite of Acetaminophen (A161220), an analgesic and antipyretic agent used as a pain reliever to treat headache, muscle aches, and arthritis (1,2,3).
References (1) McGill, M. R. and Jaeschke, H. Pharm Res. 30, 2174 (2013)(2) Fairbrother, J.E., et al.: Anal. Profiles Drug Subs., 3, 1 (1974) (3) Hinson, J.A., et al.: Rev. Biochem. Toxicol., 2, 103 (1980)Formula:C9H11NO2SColor and Shape:NeatMolecular weight:197.25
