CAS 37398-24-6

Phenol, 2,2′-dithiobis[4-nitro-

Description:

Phenol, 2,2′-dithiobis[4-nitro-] is an organic compound characterized by the presence of a phenolic structure and two nitro groups attached to the aromatic rings. It features a dithiobis linkage, which consists of two sulfur atoms bridging two phenolic units. This compound is typically used in various chemical applications, including as a reagent in organic synthesis and as a potential antioxidant due to its ability to donate electrons. The nitro groups contribute to its electron-withdrawing properties, influencing its reactivity and solubility in different solvents. Phenol derivatives, including this compound, often exhibit biological activity, making them of interest in medicinal chemistry and materials science. Additionally, the presence of sulfur in the structure may impart unique properties, such as increased stability or specific interactions with biological targets. Safety considerations are important when handling this compound, as it may pose health risks, including toxicity and environmental hazards. Proper laboratory practices should be followed to mitigate any risks associated with its use.

Formula: C₁₂H₈N₂O₆S₂

InChI: InChI=1S/C12H8N2O6S2/c15-9-3-1-7(13(17)18)5-11(9)21-22-12-6-8(14(19)20)2-4-10(12)16/h1-6,15-16H

InChI key: InChIKey=BBIPAKDGNUYVBM-UHFFFAOYSA-N

SMILES: S(SC1=CC(N(=O)=O)=CC=C1O)C2=CC(N(=O)=O)=CC=C2O

Synonyms:

• Phenol, 2,2′-dithiobis[4-nitro-
• Bis(2-hydroxy-5-nitrophenol)disulfide

Bis(2-hydroxy-5-nitrophenol)disulfide Disodium Salt

Controlled Product

CAS: 37398-24-6

Applications Used in the synthesis of phenacetin metabolites.
References Focella, A. et al.: Can. J. Chem. 50, 2025 (1972)

Formula: C₁₂H₆N₂Na₂O₆S₂

Color and Shape: Beige

Molecular weight: 384.295

Ref: TR-B446750