CAS 37398-25-7

1,1'-disulfanediylbis[2-(benzyloxy)-5-nitrobenzene]

Description:

1,1'-Disulfanediylbis[2-(benzyloxy)-5-nitrobenzene] is an organic compound characterized by its complex structure, which includes two nitro-substituted aromatic rings linked by a disulfide bond. The presence of benzyloxy groups enhances its solubility in organic solvents and contributes to its overall stability. The nitro groups are electron-withdrawing, which can influence the compound's reactivity and potential applications in organic synthesis or as a precursor in materials science. This compound may exhibit interesting electronic properties due to the conjugation between the aromatic systems and the nitro groups. Additionally, the disulfide linkage can provide unique redox properties, making it a candidate for studies in biochemistry or materials that require specific oxidative or reductive conditions. Its CAS number, 37398-25-7, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and advanced materials. However, specific safety and handling guidelines should be followed due to the potential hazards associated with its chemical structure.

Formula: C₂₆H₂₀N₂O₆S₂

InChI: InChI=1/C26H20N2O6S2/c29-27(30)21-11-13-23(33-17-19-7-3-1-4-8-19)25(15-21)35-36-26-16-22(28(31)32)12-14-24(26)34-18-20-9-5-2-6-10-20/h1-16H,17-18H2

SMILES: c1ccc(cc1)COc1ccc(cc1SSc1cc(ccc1OCc1ccccc1)N(=O)=O)N(=O)=O

Synonyms:

• Bis[5-nitro-2-(phenylMethoxy)phenyl] Disulfide

Bis(2-benzyloxy-3-nitrophenyl)disulfide

Controlled Product

CAS: 37398-25-7

Applications Bis(2-benzyloxy-3-nitrophenyl)disulfide (cas# 37398-25-7) is a compound useful in organic synthesis.

Formula: C₂₆H₂₀N₂O₆S₂

Color and Shape: Neat

Molecular weight: 520.58

Ref: TR-B410950