CAS 37398-28-0
:S-[5-(Acetylamino)-2-(phenylmethoxy)phenyl]-N-[(phenylmethoxy)carbonyl]cysteine methyl ester
Description:
S-[5-(Acetylamino)-2-(phenylmethoxy)phenyl]-N-[(phenylmethoxy)carbonyl]cysteine methyl ester, with the CAS number 37398-28-0, is a synthetic compound that belongs to the class of cysteine derivatives. This compound features a cysteine backbone modified with various functional groups, including an acetylamino group and phenylmethoxy moieties, which contribute to its chemical properties and potential biological activity. The presence of the methyl ester group suggests that it may exhibit enhanced lipophilicity, potentially influencing its solubility and permeability in biological systems. The structural complexity of this compound indicates that it may interact with biological targets, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the precise arrangement of its functional groups and the overall molecular conformation. Further studies would be necessary to elucidate its pharmacological properties and potential applications in therapeutic contexts.
Formula:C27H28N2O6S
InChI:InChI=1S/C27H28N2O6S/c1-19(30)28-22-13-14-24(34-16-20-9-5-3-6-10-20)25(15-22)36-18-23(26(31)33-2)29-27(32)35-17-21-11-7-4-8-12-21/h3-15,23H,16-18H2,1-2H3,(H,28,30)(H,29,32)
InChI key:InChIKey=PTKFYPRDXJFAKO-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(SCC(NC(OCC3=CC=CC=C3)=O)C(OC)=O)C=C(NC(C)=O)C=C2
Synonyms:- Cysteine, S-[5-(acetylamino)-2-(phenylmethoxy)phenyl]-N-[(phenylmethoxy)carbonyl]-, methyl ester
- S-[5-(Acetylamino)-2-(phenylmethoxy)phenyl]-N-[(phenylmethoxy)carbonyl]cysteine methyl ester
- DL-Cysteine, S-[5-(acetylamino)-2-(phenylmethoxy)phenyl]-N-[(phenylmethoxy)carbonyl]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Benzyloxycarbonyl-5-(3-acetamido-6-benzyloxypenyl)cysteine Methyl Ester
CAS:Controlled Product<p>Applications N-Benzyloxycarbonyl-5-(3-acetamido-6-benzyloxypenyl)cysteine Methyl Ester (cas# 37398-28-0) is a compound useful in organic synthesis.<br></p>Formula:C27H28N2O6SColor and Shape:NeatMolecular weight:508.59
