CAS 374-09-4
:P-(Trifluoromethyl)phosphonic acid
Description:
P-(Trifluoromethyl)phosphonic acid, with the CAS number 374-09-4, is a chemical compound characterized by the presence of a phosphonic acid functional group and a trifluoromethyl group. This compound is typically a colorless to pale yellow liquid and is known for its high polarity and solubility in polar solvents, such as water and alcohols. The trifluoromethyl group imparts unique electronic properties, enhancing its reactivity and making it a valuable intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. P-(Trifluoromethyl)phosphonic acid exhibits strong acidity due to the presence of the phosphonic acid moiety, which can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, it is important to handle this compound with care, as it may pose health and environmental risks. Proper safety measures should be observed when working with this substance in laboratory or industrial settings.
Formula:CH2F3O3P
InChI:InChI=1S/CH2F3O3P/c2-1(3,4)8(5,6)7/h(H2,5,6,7)
InChI key:InChIKey=XJAAVVLEUZQVNJ-UHFFFAOYSA-N
SMILES:C(P(=O)(O)O)(F)(F)F
Synonyms:- (Trifluoromethyl)phosphonic acid
- Trifluoromethanephosphonic acid
- Phosphonic acid, P-(trifluoromethyl)-
- Phosphonic acid, (trifluoromethyl)-
- P-(Trifluoromethyl)phosphonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Trifluoromethylphosphonic acid
CAS:Trifluoromethylphosphonic acidPurity:97%Molecular weight:149.99g/molTrifluoromethylphosphonic Acid
CAS:Trifluoromethylphosphonic acid is a polarizer that has been used to create polymers with hydroxy, carboxylic and other polar groups. It is also used in the production of acrylics, cationic polymerization, and membrane systems. Trifluoromethylphosphonic acid has a high viscosity and can be used as a solvent. It also reacts with nitrogen atoms to form an x-ray crystal structure. Trifluoromethylphosphonic acid is soluble in water and produces an acidic solution. The hydroxyl group on this compound is responsible for its high polarity.Formula:CH2F3O3PPurity:Min. 95%Molecular weight:149.99 g/mol

