CAS 374-32-3
:2,2,3,3-tetrafluorocyclobutanol
Description:
2,2,3,3-Tetrafluorocyclobutanol is a fluorinated organic compound characterized by its unique cyclobutane structure, which is a four-membered carbon ring. The presence of four fluorine atoms attached to the carbon backbone significantly influences its chemical properties, including increased electronegativity and altered reactivity compared to non-fluorinated analogs. This compound is typically a colorless liquid at room temperature and exhibits a high degree of stability due to the strong carbon-fluorine bonds. Its fluorinated nature imparts hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. 2,2,3,3-Tetrafluorocyclobutanol is of interest in various fields, including materials science and pharmaceuticals, due to its potential applications in developing fluorinated intermediates and specialty chemicals. Additionally, its unique structure may contribute to specific interactions in biological systems, warranting further investigation into its potential biological activity and environmental impact. Safety data should be reviewed before handling, as fluorinated compounds can exhibit unique toxicological profiles.
Formula:C4H4F4O
InChI:InChI=1/C4H4F4O/c5-3(6)1-2(9)4(3,7)8/h2,9H,1H2
SMILES:C1C(C(C1(F)F)(F)F)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2,3,3-Tetrafluorocyclobutanol, 95%
CAS:2,2,3,3-Tetrafluorocyclobutanol is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKUFormula:C4H4F4OPurity:95%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:144.072,2,3,3-Tetrafluorocyclobutanol
CAS:2,2,3,3-TetrafluorocyclobutanolFormula:C4H4F4OPurity:≥95%Color and Shape: clear. faint yellow liquidMolecular weight:144.07g/mol


