CAS 374-42-5

1,1,2,2-Tetrafluoroethanesulfonyl chloride

Description:

1,1,2,2-Tetrafluoroethanesulfonyl chloride, with the CAS number 374-42-5, is a chemical compound characterized by its sulfonyl chloride functional group and the presence of four fluorine atoms attached to an ethane backbone. This compound is typically a colorless to pale yellow liquid that is highly reactive, particularly with water and alcohols, leading to the release of hydrogen chloride gas. It is known for its strong electrophilic nature, making it useful in various chemical synthesis processes, particularly in the production of fluorinated compounds. The presence of fluorine atoms imparts unique properties, such as increased thermal stability and resistance to chemical degradation. Due to its reactivity, it must be handled with care, as it can cause severe burns upon contact with skin and is harmful if inhaled or ingested. Additionally, it is important to store this compound in a cool, dry place, away from moisture and incompatible materials to prevent hazardous reactions.

Formula: C₂HClF₄O₂S

InChI: InChI=1S/C2HClF4O2S/c3-10(8,9)2(6,7)1(4)5/h1H

InChI key: InChIKey=KNVMLYXDZUGCQJ-UHFFFAOYSA-N

SMILES: C(S(Cl)(=O)=O)(C(F)F)(F)F

Synonyms:

• 1,1,2,2-Tetrafluoroethane-1-sulfonyl chloride
• 1,1,2,2-Tetrafluoroethanesulfonyl chloride
• Ethanesulfonyl chloride, 1,1,2,2-tetrafluoro-

1,1,2,2-tetrafluoroethanesulfonyl chloride

CAS: 374-42-5

1,1,2,2-tetrafluoroethanesulfonyl chloride

Purity: ≥95%

Molecular weight: 200.54g/mol

Ref: 54-PC99587