CAS 374-76-5
:perfluoro-1,3,5-trimethylcyclohexane
Description:
Perfluoro-1,3,5-trimethylcyclohexane, with the CAS number 374-76-5, is a fluorinated organic compound characterized by its fully fluorinated cyclohexane structure, where all hydrogen atoms are replaced by fluorine atoms. This compound exhibits high thermal and chemical stability, making it resistant to degradation under various conditions. Its unique structure contributes to low surface tension and high hydrophobicity, which can lead to interesting applications in fields such as lubrication, coatings, and as a solvent in chemical processes. Additionally, perfluorinated compounds like this one are known for their low reactivity and high resistance to biological degradation, raising environmental concerns regarding their persistence in ecosystems. The compound is typically colorless and odorless, and its physical properties, such as boiling and melting points, are influenced by the presence of fluorine atoms, which impart distinct characteristics compared to their non-fluorinated counterparts. Overall, perfluoro-1,3,5-trimethylcyclohexane is notable for its stability and unique chemical behavior, making it a subject of interest in both industrial and environmental chemistry.
Formula:C9F18
InChI:InChI=1/C9F18/c10-1(7(19,20)21)4(13,14)2(11,8(22,23)24)6(17,18)3(12,5(1,15)16)9(25,26)27
SMILES:C1(C(C(C(C(C1(F)F)(C(F)(F)F)F)(F)F)(C(F)(F)F)F)(F)F)(C(F)(F)F)F
Synonyms:- 1,1,2,3,3,4,5,5,6-Nonafluoro-2,4,6-Tris(Trifluoromethyl)Cyclohexane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Perfluoro-1,3,5-trimethylcyclohexane, mixture of isomers, tech.
CAS:It finds its application in the characterization of non-aqueous phase liquid/tracer interaction in support of a vadose zone partitioning interwell tracer test. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informa
Formula:C9F18Color and Shape:liquid, Clear, colourlessMolecular weight:450.07Perfluoro(1,3,5-trimethylcyclohexane)
CAS:Perfluoro(1,3,5-trimethylcyclohexane)Formula:C9F18Purity:techColor and Shape: clear liquidMolecular weight:450.07g/molPerfluoro-1,3,5-trimethylcyclohexane
CAS:Controlled ProductPerfluoro-1,3,5-trimethylcyclohexane is a volatile organic solvent with a high vapor pressure. It has been used in industry as an innovative solvent in applications such as degreasing and dry cleaning. Its acute lung toxicity has been studied in rats by injection and inhalation. The results showed that it causes acute lung injury, with cellular changes and alveolar destruction. This chemical does not have a long half-life or significant toxicologic effects on the liver or kidneys. The low vapor pressure of this chemical makes it less hazardous to humans than other volatile organic solvents.Formula:C9F18Purity:Min. 95%Molecular weight:450.07 g/mol



