CAS 374063-88-4

2-[(2-aminoethyl)amino]-3-nitrobenzoic acid

Description:

2-[(2-aminoethyl)amino]-3-nitrobenzoic acid, also known by its CAS number 374063-88-4, is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with a nitro group and an aminoethyl side chain. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of both amino and carboxylic acid functional groups. The nitro group contributes to its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The amino groups can participate in hydrogen bonding, enhancing its interactions in biological systems. Additionally, the compound may exhibit acidic properties due to the carboxylic acid group, allowing it to act as a proton donor in various chemical reactions. Overall, its unique functional groups suggest potential applications in pharmaceuticals or as a biochemical probe, although specific applications would depend on further research into its biological activity and interactions.

Formula: C₉H₁₁N₃O₄

InChI: InChI=1/C9H11N3O4/c10-4-5-11-8-6(9(13)14)2-1-3-7(8)12(15)16/h1-3,11H,4-5,10H2,(H,13,14)

SMILES: c1cc(c(c(c1)N(=O)=O)NCCN)C(=O)O

Synonyms:

• Benzoic Acid, 2-[(2-Aminoethyl)Amino]-3-Nitro-
• 2-[(2-Aminoethyl)amino]-3-nitrobenzoic acid

2[(2-Aminoethyl)amino]-3-nitrobenzoic acid

CAS: 374063-88-4

2[(2-Aminoethyl)amino]-3-nitrobenzoic acid

Purity: ≥95%

Ref: 54-OR01479

2-[(2-aminoethyl)amino]-3-nitrobenzoic acid

CAS: 374063-88-4

Formula: C₉H₁₁N₃O₄

Purity: 95.0%

Molecular weight: 225.204

Ref: 10-F526092