CAS 374064-07-0

2-(2-pyridin-3-yl-1H-indol-3-yl)ethanaminium

Description:

2-(2-Pyridin-3-yl-1H-indol-3-yl)ethanaminium, with the CAS number 374064-07-0, is a chemical compound characterized by its complex structure, which includes an indole moiety and a pyridine ring. This compound typically exhibits properties associated with both aromatic systems, such as stability and potential for π-π stacking interactions. It is likely to be a zwitterionic species due to the presence of both a positively charged ammonium group and a neutral indole nitrogen, which can influence its solubility and reactivity. The presence of the pyridine ring may impart additional basicity and potential for coordination with metal ions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research into its properties and interactions.

Formula: C₁₅H₁₆N₃

InChI: InChI=1/C15H15N3/c16-8-7-13-12-5-1-2-6-14(12)18-15(13)11-4-3-9-17-10-11/h1-6,9-10,18H,7-8,16H2/p+1

2-(2-Pyridin-3-yl-1H-indol-3-yl)ethylamine hydrochloride

CAS: 374064-07-0

2-(2-Pyridin-3-yl-1H-indol-3-yl)ethylamine hydrochloride

Purity: ≥95%

Molecular weight: 273.76g/mol

Ref: 54-OR01509

2-[2-(pyridin-3-yl)-1H-indol-3-yl]ethan-1-amine hydrochloride

CAS: 374064-07-0

Purity: 95.0%

Molecular weight: 273.760009765625

Ref: 10-F526101