CAS 3741-24-0

1,1'-bipyrrolidine-2,2',5,5'-tetrone

Description:

1,1'-Bipyrrolidine-2,2',5,5'-tetrone, with the CAS number 3741-24-0, is a chemical compound characterized by its unique structure, which consists of two pyrrolidine rings connected by a tetrone moiety. This compound typically exhibits a solid state at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry due to its ability to act as a versatile building block. The presence of multiple carbonyl groups in the tetrone structure contributes to its reactivity, allowing it to participate in various chemical reactions, including condensation and cyclization processes. Additionally, the compound may display interesting properties such as solubility in polar solvents and the ability to form hydrogen bonds, which can influence its behavior in biological systems. Its stability and reactivity can vary depending on the specific conditions, such as pH and temperature, making it a subject of interest for further research in both synthetic and applied chemistry.

Formula: C₈H₈N₂O₄

InChI: InChI=1/C8H8N2O4/c11-5-1-2-6(12)9(5)10-7(13)3-4-8(10)14/h1-4H2

SMILES: C1CC(=O)N(C1=O)N1C(=O)CCC1=O

Synonyms:

• N,N'-Bisuccinimide

[1,1'-Bipyrrolidine]-2,2',5,5'-tetraone

CAS: 3741-24-0

[1,1'-Bipyrrolidine]-2,2',5,5'-tetraone

Purity: 95%

Molecular weight: 196.16g/mol

Ref: 54-OR1052049

L, L'-Bisuccinimide

Controlled Product

CAS: 3741-24-0

Applications L, L'-Bisuccinimide is great oil antioxidant detergent compound.
References Wen, Y., et al.: Faming Zhuanli Shenqing, (2020);

Formula: C₈H₈N₂O₄

Color and Shape: Neat

Molecular weight: 196.16

Ref: TR-B703983