CymitQuimica logo

CAS 374104-63-9

:

4-chloro-5-(4-methylphenyl)thieno[2,3-d]pyrimidine

Description:
4-Chloro-5-(4-methylphenyl)thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its unique structure, which includes a thieno[2,3-d]pyrimidine core fused with a chloro substituent and a para-methylphenyl group. This compound typically exhibits a solid-state form and is known for its potential biological activity, making it of interest in pharmaceutical research. The presence of the chlorine atom and the methylphenyl group can influence its solubility, reactivity, and interaction with biological targets. It may also exhibit specific spectral properties, such as UV-Vis and NMR characteristics, which can be used for identification and analysis. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies. As with many heterocycles, its reactivity can be modulated through various chemical transformations, allowing for the synthesis of derivatives with altered properties. Safety and handling precautions should be observed due to its potential biological activity and the presence of chlorine, which can impart toxicity.
Formula:C13H9ClN2S
InChI:InChI=1/C13H9ClN2S/c1-8-2-4-9(5-3-8)10-6-17-13-11(10)12(14)15-7-16-13/h2-7H,1H3
InChI key:IJQIOVCRRZEROH-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)c1csc2c1c(Cl)ncn2
Synonyms:
  • Thieno[2,3-d]pyrimidine, 4-chloro-5-(4-methylphenyl)-
  • 4-Chloro-5-(4-methylphenyl)thieno[2,3-d]pyrimidine
Found 4 products.