CAS 37428-73-2

1-(tricyclo[3.3.1.1~3,7~]dec-1-yl)imidazolidine-2,4,5-trione

Description:

1-(Tricyclo[3.3.1.1~3,7~]dec-1-yl)imidazolidine-2,4,5-trione, with CAS number 37428-73-2, is a chemical compound characterized by its unique bicyclic structure, which includes a tricyclic decalin framework fused to an imidazolidine ring. This compound features multiple functional groups, including imidazolidine and carbonyl groups, contributing to its reactivity and potential applications in organic synthesis. The presence of the tricyclic system imparts rigidity to the molecule, influencing its conformational properties and interactions with other substances. It may exhibit interesting biological activities due to its structural complexity, making it a candidate for further research in medicinal chemistry. Additionally, the compound's stability and solubility can vary depending on the solvent and conditions, which are important factors to consider in practical applications. Overall, this compound represents a fascinating example of how intricate molecular architectures can lead to diverse chemical behaviors and potential utility in various fields, including pharmaceuticals and materials science.

Formula: C₁₃H₁₆N₂O₃

InChI: InChI=1/C13H16N2O3/c16-10-11(17)15(12(18)14-10)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-9H,1-6H2,(H,14,16,18)

SMILES: C1C2CC3CC1CC(C2)(C3)N1C(=O)C(=NC1=O)O

Synonyms:

• 1-(1-Adamantyl)Imidazolidine-2,4,5-Trione

1-(Adamantan-1-yl)imidazolidine-2,4,5-trione

CAS: 37428-73-2

Versatile small molecule scaffold

Formula: C₁₃H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 248.28 g/mol

Ref: 3D-MBA42873