CAS 3743-07-5
:dimethyl phosphorochloridoite
Description:
Dimethyl phosphorochloridoite is an organophosphorus compound characterized by its structure, which includes a phosphorus atom bonded to two methyl groups, a chlorine atom, and an oxygen atom. This compound is typically classified as a phosphorochloridate, which indicates the presence of a chlorine substituent on the phosphorus atom. It is known for its reactivity, particularly in the context of chemical synthesis and potential applications in agriculture as a pesticide or herbicide. The presence of the chlorido group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, due to its phosphorus content, it may exhibit properties associated with phosphonates, such as potential toxicity and environmental persistence. Safety precautions are essential when handling this compound, as it may pose health risks if inhaled or ingested. Overall, dimethyl phosphorochloridoite is a significant compound in the field of organophosphorus chemistry, with implications in both industrial and agricultural applications.
Formula:C2H6ClO2P
InChI:InChI=1/C2H6ClO2P/c1-4-6(3)5-2/h1-2H3
SMILES:COP(Cl)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dimethyl Chlorophosphite
CAS:Controlled ProductFormula:C2H6ClO2PColor and Shape:NeatMolecular weight:128.495
