CymitQuimica logo

CAS 37434-06-3

:

4-4-dithiobisphenyl-azide

Description:
4,4'-Dithiobisphenyl azide is an organic compound characterized by its azide functional group and dithiobisphenyl structure. It typically appears as a solid at room temperature and is known for its stability under normal conditions, although it can be sensitive to heat and light. The compound features two phenyl rings connected by a dithiobis linkage, which contributes to its unique chemical properties. As an azide, it contains the functional group -N3, which is known for its ability to undergo thermal decomposition, leading to the release of nitrogen gas and the formation of reactive intermediates. This property makes 4,4'-dithiobisphenyl azide useful in various applications, including photochemistry and materials science, where it can serve as a precursor for the synthesis of polymers or as a cross-linking agent. However, due to the potential hazards associated with azides, including toxicity and explosive behavior under certain conditions, proper handling and safety precautions are essential when working with this compound.
Formula:C12H8N6S2
InChI:InChI=1/C12H8N6S2/c13-17-15-9-1-5-11(6-2-9)19-20-12-7-3-10(4-8-12)16-18-14/h1-8H
SMILES:C1=CC(=S=S=C2C=CC(=NN=[NH-])C=C2)C=CC1=N[N+]#N
Synonyms:
  • Dithiobisphenyl azide
  • 4-Azidophenyl disulfide (4,4-dithiobis-(phenylazide))
  • 1,1'-Disulfanediylbis(4-Azidobenzene)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.