CAS 37439-78-4

N-[3-(prop-2-en-1-yloxy)phenyl]acetamide

Description:

N-[3-(prop-2-en-1-yloxy)phenyl]acetamide, with the CAS number 37439-78-4, is an organic compound characterized by its amide functional group and an allyloxy substituent on a phenyl ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the allyloxy group suggests that it may participate in various chemical reactions, such as polymerization or substitution reactions, due to the presence of the double bond. The acetamide moiety can influence the compound's hydrogen bonding capabilities, affecting its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals or as a building block in organic synthesis. Overall, N-[3-(prop-2-en-1-yloxy)phenyl]acetamide is a versatile compound with properties that can be tailored for specific applications in chemical research and industry.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1/C11H13NO2/c1-3-7-14-11-6-4-5-10(8-11)12-9(2)13/h3-6,8H,1,7H2,2H3,(H,12,13)

SMILES: C=CCOc1cccc(c1)N=C(C)O

N-[3-(Prop-2-en-1-yloxy)phenyl]acetamide

CAS: 37439-78-4

Versatile small molecule scaffold

Formula: C₁₁H₁₃NO₂

Purity: Min. 95%

Molecular weight: 191.23 g/mol

Ref: 3D-MBA43978