CAS 37439-92-2
:10-(1-Piperidinyl)-5H-dibenzo[a,d]cyclohepten-5-one
Description:
10-(1-Piperidinyl)-5H-dibenzo[a,d]cyclohepten-5-one, identified by its CAS number 37439-92-2, is a chemical compound that belongs to the class of dibenzo[a,d]cycloheptenes. This compound features a piperidine ring, which contributes to its potential biological activity. Structurally, it consists of a fused bicyclic system that includes a ketone functional group, which can influence its reactivity and interactions with biological targets. The presence of the piperidine moiety suggests that it may exhibit properties relevant to pharmacology, potentially acting as a ligand for various receptors. The compound's unique structure may also impart specific physical and chemical properties, such as solubility and stability, which are important for its application in research or medicinal chemistry. Overall, while detailed studies on its specific characteristics and applications may be limited, the structural features indicate potential utility in various chemical and biological contexts.
Formula:C20H19NO
InChI:InChI=1S/C20H19NO/c22-20-16-9-3-2-8-15(16)14-19(21-12-6-1-7-13-21)17-10-4-5-11-18(17)20/h2-5,8-11,14H,1,6-7,12-13H2
InChI key:InChIKey=KIPXMFZJKGQNDR-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=CC=3C1=CC=CC3)N4CCCCC4)=CC=CC2
Synonyms:- 10-(1-Piperidinyl)-5H-dibenzo[a,d]cyclohepten-5-one
- 10-Piperidin-1-yl-dibenzo[a,d]cyclohepten-5-one
- 5H-Dibenzo[a,d]cyclohepten-5-one, 10-piperidino-
- 5H-dibenzo[a,d]cyclohepten-5-one, 10-(1-piperidinyl)-
- 10-(Piperidin-1-yl)-5H-dibenzo[a,d][7]annulen-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
10-Piperidinyl-5-dibenzosuberenone
CAS:Controlled ProductFormula:C20H19NOColor and Shape:NeatMolecular weight:289.371
