CAS 37441-50-2
:1,2-thiazinane 1,1-dioxide
Description:
1,2-Thiazinane 1,1-dioxide, also known as thiazolidine 1,1-dioxide, is a heterocyclic organic compound characterized by a six-membered ring containing both sulfur and nitrogen atoms. The structure features a thiazine ring with a sulfonyl group, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in polar solvents such as water and alcohols. It exhibits a range of chemical reactivity due to the presence of the sulfonyl group, making it useful in various synthetic applications. 1,2-Thiazinane 1,1-dioxide is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, it can serve as a building block in the synthesis of more complex molecules in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, following appropriate safety protocols to minimize exposure and risks.
Formula:C4H9NO2S
InChI:InChI=1/C4H9NO2S/c6-8(7)4-2-1-3-5-8/h5H,1-4H2
SMILES:C1CCS(=O)(=O)NC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,4-Butanesultam
CAS:Formula:C4H9NO2SPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:135.181,2-Thiazinane 1,1-dioxide
CAS:1,2-Thiazinane 1,1-dioxideFormula:C4H9NO2SPurity:99%Color and Shape: yellow solidMolecular weight:135.18g/mol1,2-Thiazinane 1,1-dioxide
CAS:Formula:C4H9NO2SPurity:95%Color and Shape:SolidMolecular weight:135.181lambda6,2-thiazinane-1,1-dione
CAS:1,2-Thiazinane-1,1-dione is a short-chain alkylating agent that has been shown to have neuropathic and inflammatory pain relief. It binds to a number of halides and inhibits their action, including the inhibition of angiotensin I-converting enzyme (ACE), which is an antihypertensive agent. 1,2-Thiazinane-1,1-dione also inhibits the production of epoxides in c1-4 alkyl groups. This drug also has antibacterial properties and can be used as a chemical probe for ligand binding studies.
Formula:C4H9NO2SPurity:Min. 95%Molecular weight:135.2 g/mol




