CAS 374538-02-0: 5-(3-Phenoxyphenyl)-2H-tetrazole
Description:5-(3-Phenoxyphenyl)-2H-tetrazole is an organic compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. This compound features a phenoxyphenyl substituent, indicating the presence of a phenoxy group attached to a phenyl ring, contributing to its aromatic character and potential for various interactions. The tetrazole moiety is known for its stability and ability to participate in diverse chemical reactions, making it a valuable scaffold in medicinal chemistry and material science. The compound may exhibit interesting biological activities, including potential use as an anti-inflammatory or antimicrobial agent, although specific biological properties would depend on further empirical studies. Its molecular structure suggests it may engage in hydrogen bonding and π-π stacking interactions, which could influence its solubility and reactivity. Overall, 5-(3-Phenoxyphenyl)-2H-tetrazole represents a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C13H10N4O
InChI:InChI=1S/C13H10N4O/c1-2-6-11(7-3-1)18-12-8-4-5-10(9-12)13-14-16-17-15-13/h1-9H,(H,14,15,16,17)
InChI key:InChIKey=TYNITQBHBADQAR-UHFFFAOYSA-N
SMILES:N1=NNC(=N1)C=2C=CC=C(OC=3C=CC=CC3)C2
- Synonyms:
- 1H-tetrazole, 5-(3-phenoxyphenyl)-
- 2H-tetrazole, 5-(3-phenoxyphenyl)-
- 5-(3-phenoxyphenyl)-2H-tetrazole
- 5-(3-PHENOXYPHENYL)-1H-TETRAZOLE
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-(3-PHENOXYPHENYL)-1H-TETRAZOLE REF: IN-DA00BYI9CAS: 374538-02-0 | 95% | To inquire | Tue 06 May 25 |
![]() | 5-(3-phenoxyphenyl)-1H-1,2,3,4-tetrazole REF: 10-F722219CAS: 374538-02-0 | 98+% | To inquire | Wed 14 May 25 |
![]() | 5-(3-Phenoxyphenyl)-1H-tetrazole REF: 3D-ZPA53802CAS: 374538-02-0 | Min. 95% | - - - | Discontinued product |

5-(3-PHENOXYPHENYL)-1H-TETRAZOLE
Ref: IN-DA00BYI9
1g | 202.00 € | ||
5g | To inquire | ||
100mg | 131.00 € | ||
250mg | 152.00 € |

Ref: 10-F722219
5g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

5-(3-Phenoxyphenyl)-1H-tetrazole
Ref: 3D-ZPA53802
5g | Discontinued | Request information | |
10g | Discontinued | Request information |