CAS 3746-39-2
:dodecyl mercaptoacetate
Description:
Dodecyl mercaptoacetate, with the CAS number 3746-39-2, is an organosulfur compound characterized by its long hydrophobic dodecyl chain and a functional mercaptoacetate group. This compound typically appears as a viscous liquid and is soluble in organic solvents, while being less soluble in water due to its hydrophobic nature. The presence of the mercapto group (-SH) imparts thiol characteristics, making it reactive and capable of forming disulfide bonds, which can be useful in various chemical reactions and applications, including polymer chemistry and surface modification. Dodecyl mercaptoacetate is often utilized as a surfactant or emulsifier in formulations, enhancing the stability and performance of products. Additionally, its structure allows for potential applications in the synthesis of nanoparticles and as a coupling agent in various chemical processes. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be employed.
Formula:C14H28O2S
InChI:InChI=1/C14H28O2S/c1-2-3-4-5-6-7-8-9-10-11-12-16-14(15)13-17/h17H,2-13H2,1H3
InChI key:InChIKey=TVMDUMQNXXNGMG-UHFFFAOYSA-N
SMILES:C(COC(CS)=O)CCCCCCCCCC
Synonyms:- Dodecyl mercaptoacetate
- dodecyl sulfanylacetate
- HSDB 2703
- Dodecyl thioglycolate
- Acetic acid, 2-mercapto-, dodecyl ester
- Acetic acid, mercapto-, dodecyl ester
- Lauryl thioglycolate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.