CAS 374633-33-7

3-Bromo-2-hydroxy-6-picoline

Description:

3-Bromo-2-hydroxy-6-picoline is an organic compound characterized by its bromine and hydroxyl functional groups attached to a pyridine ring. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The hydroxyl group contributes to its potential as a hydrogen bond donor, enhancing its interactions in various chemical environments. This compound is part of the picoline family, which are methyl derivatives of pyridine, and its specific positioning of substituents can affect its biological activity and chemical properties. Typically, compounds like 3-Bromo-2-hydroxy-6-picoline may exhibit properties such as moderate polarity, making them soluble in polar solvents while retaining some hydrophobic characteristics due to the aromatic nature of the pyridine ring. Additionally, the compound may be of interest in pharmaceutical and agrochemical research due to its potential biological activities, including antimicrobial or anti-inflammatory properties. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₆H₆BrNO

InChI: InChI=1/C6H6BrNO/c1-4-2-3-5(7)6(9)8-4/h2-3H,1H3,(H,8,9)

SMILES: Cc1ccc(c(n1)O)Br

Synonyms:

• 2-Pyridinol, 3-Bromo-6-Methyl-
• 3-Bromo-6-methylpyridin-2-ol
• 3-bromo-6-methylpyridin-2(1H)-one
• 2-Hydroxy-3-Bromo-6-Methylpyridine

3-Bromo-6-methylpyridin-2-ol

CAS: 374633-33-7

Formula: C₆H₆BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0219

Ref: IN-DA0037KB

5-Bromo-6-hydroxy-2-methylpyridine

CAS: 374633-33-7

5-Bromo-6-hydroxy-2-methylpyridine

Purity: 98%

Molecular weight: 188.02g/mol

Ref: 54-OR345086

3-Bromo-2-hydroxy-6-picoline

CAS: 374633-33-7

Formula: C₆H₆BrNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.024

Ref: 10-F219295