CAS 374633-38-2

6-Bromo-3-fluoro-2-methylpyridine

Description:

6-Bromo-3-fluoro-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with bromine, fluorine, and a methyl group. The presence of the bromine atom at the 6-position and the fluorine atom at the 3-position contributes to its unique reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The methyl group at the 2-position influences the electronic properties of the molecule, enhancing its lipophilicity and potentially affecting its biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in organic solvents. It is of interest in pharmaceutical chemistry and material science due to its potential as a building block for more complex molecules. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 6-Bromo-3-fluoro-2-methylpyridine serves as a valuable intermediate in synthetic organic chemistry.

Formula: C₆H₅BrFN

InChI: InChI=1S/C6H5BrFN/c1-4-5(8)2-3-6(7)9-4/h2-3H,1H3

InChI key: InChIKey=BFQONZCQHGIKIY-UHFFFAOYSA-N

SMILES: CC1=C(F)C=CC(Br)=N1

Synonyms:

• 2-Bromo-5-fluoro-6-methylpyridine
• 6-Bromo-3-Fluoro-2-Methylpyridine
• Pyridine, 6-bromo-3-fluoro-2-methyl-

Pyridine, 6-bromo-3-fluoro-2-methyl-

CAS: 374633-38-2

Formula: C₆H₅BrFN

Purity: 96%

Color and Shape: Solid

Molecular weight: 190.0130

Ref: IN-DA00I7DJ

6-Bromo-3-fluoro-2-methylpyridine

CAS: 374633-38-2

6-Bromo-3-fluoro-2-methylpyridine

Formula: C₆H₅BrFN

Purity: 98%

Color and Shape: brown solid

Molecular weight: 190.01g/mol

Ref: 54-PC10422

2-Bromo-5-fluoro-6-methylpyridine

CAS: 374633-38-2

2-Bromo-5-fluoro-6-methylpyridine is a versatile and useful building block that can be used to synthesize complex compounds. This compound is also a high quality chemical with a CAS number of 374633-38-2. It can be used as a reagent, which means it can be used in the laboratory for various chemical reactions, or as a speciality chemical. 2-Bromo-5-fluoro-6-methylpyridine is an intermediate in the synthesis of other chemicals and has been shown to have reactive groups on both ends of the molecule, making it useful for creating scaffolds for larger molecules.

Formula: C₆H₅BrFN

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 190.01 g/mol

Ref: 3D-FB55478

6-Bromo-3-fluoro-2-methyl-pyridine

CAS: 374633-38-2

Formula: C₆H₅BrFN

Purity: 96%

Color and Shape: Solid, Off-white solid

Molecular weight: 190.015

Ref: 10-F033261