CAS 374750-32-0
:2′-C-Methylinosine
Description:
2′-C-Methylinosine is a modified nucleoside that plays a significant role in various biological processes, particularly in the context of RNA metabolism. This compound is characterized by the presence of a methyl group at the 2′ position of the ribose sugar, which distinguishes it from the standard nucleoside inosine. The modification can influence the stability and function of RNA molecules, affecting their interactions and biological activity. 2′-C-Methylinosine is often studied for its potential applications in therapeutic contexts, including antiviral strategies, as it may enhance the efficacy of RNA-based drugs. Additionally, its unique structural features contribute to its role in cellular signaling and regulation. The compound is typically analyzed using techniques such as chromatography and mass spectrometry to determine its purity and concentration in various samples. Overall, 2′-C-Methylinosine exemplifies the importance of nucleoside modifications in biochemistry and molecular biology.
Formula:C11H14N4O5
InChI:InChI=1S/C11H14N4O5/c1-11(19)7(17)5(2-16)20-10(11)15-4-14-6-8(15)12-3-13-9(6)18/h3-5,7,10,16-17,19H,2H2,1H3,(H,12,13,18)/t5-,7-,10-,11-/m1/s1
InChI key:InChIKey=IZDKLIPLXAIBNF-YRKGHMEHSA-N
SMILES:C[C@]1(O)[C@@H](O[C@H](CO)[C@H]1O)N2C3=C(N=C2)C(=O)N=CN3
Synonyms:- 2'-C-Methylinosine
- Inosine, 2′-C-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2'-β-C-Methyl inosine
CAS:2'-beta-C-Methyl inosine (2'-C-Methyl inosine) is an HCV RNA polymerase inhibitor with antiviral activity and may be used in studies to treat hcv infections.Formula:C11H14N4O5Color and Shape:SolidMolecular weight:282.252'-C-Methylinosine
CAS:<p>2'-C-Methylinosine is an analog of 2'-deoxyinosine that is used as a prodrug for the treatment of hepatitis B virus infection. It has been shown to inhibit RNA synthesis in cell cultures by competitively inhibiting the activity of rna-dependent RNA polymerase. This inhibition leads to the accumulation of unprocessed, inactive ribonucleotides, which are eventually degraded by cellular enzymes. 2'-C-Methylinosine is an analog of 2'-deoxyinosine that has been modified at the C2 position with methyl groups (hence its name). The modification increases the stability and solubility of this molecule. Clinical trials have shown that 2'-C-Methylinosine can be used to treat hepatitis B virus infection when combined with other drugs such as lamivudine or entecavir.</p>Formula:C11H14N4O5Purity:Min. 95%Molecular weight:282.25 g/mol


